missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Acide 3-(3-fluorophénylcarbamoyl)benzèneboronique, 98 %, Thermo Scientific™
51.70€ - 145.00€
Identifiants chimiques
| CAS | 874288-34-3 |
|---|---|
| Formule moléculaire | C13H11BFNO3 |
| Poids moléculaire (g/mol) | 259.043 |
| Numéro MDL | MFCD09027207 |
| Clé InChI | OJAYVDZJZDGCFF-UHFFFAOYSA-N |
| Synonyme | 3-borono-n-3-fluorophenyl benzamide, 3-3-fluorophenyl carbamoyl phenyl boronic acid, 3-3-fluorophenylcarbamoyl phenylboronic acid, 3-3-fluorophenyl carbamoyl phenylboronic acid, 3-3-fluorophenyl carbamoyl benzeneboronic acid, acmc-209qly, 3-3-fluoroanilino-oxomethyl phenyl boronic acid, 3-3-fluorophenyl amino carbonyl phenylboronic acid |
| CID PubChem | 44717663 |
| Nom IUPAC | Acide [3-[(3-fluorophényl) carbamoyl] phényl] boronique |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=CC(=CC=C2)F)(O)O |
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Identifiants chimiques
| 874288-34-3 | |
| 259.043 | |
| OJAYVDZJZDGCFF-UHFFFAOYSA-N | |
| 44717663 | |
| B(C1=CC(=CC=C1)C(=O)NC2=CC(=CC=C2)F)(O)O |
| C13H11BFNO3 | |
| MFCD09027207 | |
| 3-borono-n-3-fluorophenyl benzamide, 3-3-fluorophenyl carbamoyl phenyl boronic acid, 3-3-fluorophenylcarbamoyl phenylboronic acid, 3-3-fluorophenyl carbamoyl phenylboronic acid, 3-3-fluorophenyl carbamoyl benzeneboronic acid, acmc-209qly, 3-3-fluoroanilino-oxomethyl phenyl boronic acid, 3-3-fluorophenyl amino carbonyl phenylboronic acid | |
| Acide [3-[(3-fluorophényl) carbamoyl] phényl] boronique |
Spécification
| 3-(3-Fluorophenylcarbamoyl)benzeneboronic acid | |
| C13H11BFNO3 | |
| 3-borono-n-3-fluorophenyl benzamide, 3-3-fluorophenyl carbamoyl phenyl boronic acid, 3-3-fluorophenylcarbamoyl phenylboronic acid, 3-3-fluorophenyl carbamoyl phenylboronic acid, 3-3-fluorophenyl carbamoyl benzeneboronic acid, acmc-209qly, 3-3-fluoroanilino-oxomethyl phenyl boronic acid, 3-3-fluorophenyl amino carbonyl phenylboronic acid | |
| B(C1=CC(=CC=C1)C(=O)NC2=CC(=CC=C2)F)(O)O | |
| 259.043 | |
| 259.04 |
| 874288-34-3 | |
| MFCD09027207 | |
| OJAYVDZJZDGCFF-UHFFFAOYSA-N | |
| Acide [3-[(3-fluorophényl) carbamoyl] phényl] boronique | |
| 44717663 | |
| 98% |
Sécurité et traitement
Déclaration GHS H
H315-H319-H335
Provoque une irritation cutanée.
Provoque une grave irritation oculaire.
Peut irriter les voies respiratoires.
P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P362-P501c
H315-H319-H335
missing translation for 'tsca' : Non
Recommended Storage : Température ambiante