missing translation for 'onlineSavingsMsg'
Learn More
Learn More
![1-2-méthoxy-5-(trifluorométhoxy)phényl]éthanol, 95 %, Thermo Scientific:Produits](https://assets.fishersci.com/TFS-Assets/CCG/Chemical-Structures/chemical-structure-cas-468074-91-1.jpg-650.jpg)
![1-2-méthoxy-5-(trifluorométhoxy)phényl]éthanol, 95 %, Thermo Scientific:Produits](https://assets.fishersci.com/TFS-Assets/CCG/logos/Thermo-Scientific-Stacked.jpg-650.jpg)
1-2-méthoxy-5-(trifluorométhoxy)phényl]éthanol, 95 %, Thermo Scientific™
81.51€ - 239.00€
Identifiants chimiques
| CAS | 468074-91-1 |
|---|---|
| Formule moléculaire | C10H11F3O3 |
| Poids moléculaire (g/mol) | 236.19 |
| Numéro MDL | MFCD08062374 |
| Clé InChI | DKUPMKWSJITPFC-UHFFFAOYNA-N |
| Synonyme | 1-2-methoxy-5-trifluoromethoxy phenyl ethan-1-ol, 1-2-methoxy-5-trifluoromethoxy phenyl ethanol, 1-hydroxy-1-2-methoxy-5-triflouromethoxy phenyl ethane |
| CID PubChem | 18542515 |
| Nom IUPAC | 1-[2-méthoxy-5-(trifluorométhoxy)phényl]éthanol |
| SMILES | COC1=C(C=C(OC(F)(F)F)C=C1)C(C)O |
| Code produit | Marque | Quantité | Preis | Menge & Verfügbarkeit | |||||
|---|---|---|---|---|---|---|---|---|---|
| Produktcode | Marke | Quantité | Preis | Menge & Verfügbarkeit | |||||
|
15497885
|
Thermo Scientific Alfa Aesar
H31765.03 |
1 g |
81.51€
1g |
Veuillez vous connecter pour pouvoir commander cet article. Besoin d'un compte web? Créer le vôtre dès maintenant! | |||||
|
15407895
|
Thermo Scientific Alfa Aesar
H31765.06 |
5 g | N/A | ||||||
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemische Identifikatoren
| 468074-91-1 | |
| 236.19 | |
| DKUPMKWSJITPFC-UHFFFAOYNA-N | |
| 18542515 | |
| COC1=C(C=C(OC(F)(F)F)C=C1)C(C)O |
| C10H11F3O3 | |
| MFCD08062374 | |
| 1-2-methoxy-5-trifluoromethoxy phenyl ethan-1-ol, 1-2-methoxy-5-trifluoromethoxy phenyl ethanol, 1-hydroxy-1-2-methoxy-5-triflouromethoxy phenyl ethane | |
| 1-[2-méthoxy-5-(trifluorométhoxy)phényl]éthanol |
Spezifikation
| 1-[2-Methoxy-5-(trifluoromethoxy)phenyl]ethanol | |
| C10H11F3O3 | |
| 1-2-methoxy-5-trifluoromethoxy phenyl ethan-1-ol, 1-2-methoxy-5-trifluoromethoxy phenyl ethanol, 1-hydroxy-1-2-methoxy-5-triflouromethoxy phenyl ethane | |
| COC1=C(C=C(OC(F)(F)F)C=C1)C(C)O | |
| 236.19 | |
| 236.19 |
| 468074-91-1 | |
| MFCD08062374 | |
| DKUPMKWSJITPFC-UHFFFAOYNA-N | |
| 1-[2-méthoxy-5-(trifluorométhoxy)phényl]éthanol | |
| 18542515 | |
| 95% |
Sicherheit und Handhabung
missing translation for 'tsca' : Non
Recommended Storage : Température ambiante